CAS 1048962-49-7 appears in our catalog under these names: Trans-3-oxabicyclo[3.1.0]hexan-6-amine hydrochloride, 95%, (1α,5α,6α)-3-Oxabicyclo(3.1.0)hexan-6-amine hydrochloride, 97%, trans-3-Oxabicyclo(3.1.0)hexan-6-amine hydrochloride, (1α,5α,6α)-3-Oxabicyclo[3.1.0]hexan-6-amine hydrochloride 97%, trans-6-Amino-3-oxabicyclo[3.1.0]hexane hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg.
(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-amine;hydrochloride (CAS 1048962-49-7) is a chemical compound with the molecular formula C5H10ClNO and a molecular weight of 135.59 g/mol. IUPAC name: (1S,5R)-3-oxabicyclo[3.1.0]hexan-6-amine;hydrochloride. InChIKey: JCFIYVURKHIYFF-FLGDEJNQSA-N.
| Molecular formula | C5H10ClNO |
|---|---|
| Molecular weight | 135.59 g/mol |
| IUPAC name | (1S,5R)-3-oxabicyclo[3.1.0]hexan-6-amine;hydrochloride |
| InChIKey | JCFIYVURKHIYFF-FLGDEJNQSA-N |
| SMILES | C1[C@@H]2[C@@H](C2N)CO1.Cl |
Computed by PubChem (NCBI)