Products 1049130-67-7
CAS 1049130-67-7 is the registry number for 3-{5H,6H,7H,8H-Imidazo(1,5-a)pyridin-3-yl}aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)aniline (CAS 1049130-67-7) is a chemical compound with the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. IUPAC name: 3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)aniline. InChIKey: QFDLEXRNARNIIA-UHFFFAOYSA-N.
| Molecular formula | C13H15N3 |
|---|---|
| Molecular weight | 213.28 g/mol |
| IUPAC name | 3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)aniline |
| InChIKey | QFDLEXRNARNIIA-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=CN=C2C3=CC(=CC=C3)N)C1 |
Computed by PubChem (NCBI)