Products 104959-32-2
CAS 104959-32-2 is the registry number for 2-Chloro-2′-deoxyadenosine monophosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 104959-32-2) is a chemical compound with the molecular formula C10H13ClN5O6P and a molecular weight of 365.67 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: BXJWGKMZENUHLS-KVQBGUIXSA-N.
| Molecular formula | C10H13ClN5O6P |
|---|---|
| Molecular weight | 365.67 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | BXJWGKMZENUHLS-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)Cl)N)COP(=O)(O)O)O |
Computed by PubChem (NCBI)