CAS 1049605-59-5 appears in our catalog under these names: 2-([Bis(4-chlorophenyl)methoxy]methyl)oxirane, 95%, 2-{(bis(4-chlorophenyl)methoxy)methyl}oxirane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[bis(4-chlorophenyl)methoxymethyl]oxirane (CAS 1049605-59-5) is a chemical compound with the molecular formula C16H14Cl2O2 and a molecular weight of 309.2 g/mol. IUPAC name: 2-[bis(4-chlorophenyl)methoxymethyl]oxirane. InChIKey: GKWPFUSVMXXVND-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 2-[bis(4-chlorophenyl)methoxymethyl]oxirane |
| InChIKey | GKWPFUSVMXXVND-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)