CAS 1049728-18-8 is the registry number for N-(4-Chloro-2-nitrophenyl)ethane-1,2-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
N'-(4-chloro-2-nitrophenyl)ethane-1,2-diamine;hydrochloride (CAS 1049728-18-8) is a chemical compound with the molecular formula C8H11Cl2N3O2 and a molecular weight of 252.09 g/mol. IUPAC name: N'-(4-chloro-2-nitrophenyl)ethane-1,2-diamine;hydrochloride. InChIKey: JHTCIAODLBQFGR-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3O2 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | N'-(4-chloro-2-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| InChIKey | JHTCIAODLBQFGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])NCCN.Cl |
Computed by PubChem (NCBI)