CAS 1049731-01-2 is the registry number for 2-Bromo-1-iodo-3-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-1-iodo-3-(trifluoromethyl)benzene (CAS 1049731-01-2) is a chemical compound with the molecular formula C7H3BrF3I and a molecular weight of 350.90 g/mol. IUPAC name: 2-bromo-1-iodo-3-(trifluoromethyl)benzene. InChIKey: NANPAHUEDRWAJP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3I |
|---|---|
| Molecular weight | 350.90 g/mol |
| IUPAC name | 2-bromo-1-iodo-3-(trifluoromethyl)benzene |
| InChIKey | NANPAHUEDRWAJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)Br)C(F)(F)F |
Computed by PubChem (NCBI)