CAS 1049732-72-0 is the registry number for 4-(2,5-Dimethyl-1-propyl-1H-pyrrol-3-yl)-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(2,5-dimethyl-1-propylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1049732-72-0) is a chemical compound with the molecular formula C12H18ClN3S and a molecular weight of 271.81 g/mol. IUPAC name: 4-(2,5-dimethyl-1-propylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: ZOLBKOGTMIRWAV-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3S |
|---|---|
| Molecular weight | 271.81 g/mol |
| IUPAC name | 4-(2,5-dimethyl-1-propylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | ZOLBKOGTMIRWAV-UHFFFAOYSA-N |
| SMILES | CCCN1C(=CC(=C1C)C2=CSC(=N2)N)C.Cl |
Computed by PubChem (NCBI)