CAS 1049737-29-2 is the registry number for 2-(7-Iodo-2-methyl-1H-indol-3-yl)ethanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
2-(7-iodo-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049737-29-2) is a chemical compound with the molecular formula C11H14ClIN2 and a molecular weight of 336.60 g/mol. IUPAC name: 2-(7-iodo-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: MDUDVMYVOKEOAE-UHFFFAOYSA-N.
| Molecular formula | C11H14ClIN2 |
|---|---|
| Molecular weight | 336.60 g/mol |
| IUPAC name | 2-(7-iodo-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | MDUDVMYVOKEOAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC=C2)I)CCN.Cl |
Computed by PubChem (NCBI)