CAS 1049738-54-6 appears in our catalog under these names: ERK-IN-4, 97%, ERK-IN-4/ 99.84% (existing batch purity), ERK Inhibitor, ERK inhibitor, ERK-IN-4, 98.30%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
3-(2-aminoethyl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (CAS 1049738-54-6) is a chemical compound with the molecular formula C14H17ClN2O3S and a molecular weight of 328.8 g/mol. IUPAC name: 3-(2-aminoethyl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride. InChIKey: PQVLWVGMXJPJLG-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O3S |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | 3-(2-aminoethyl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| InChIKey | PQVLWVGMXJPJLG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C=C2C(=O)N(C(=O)S2)CCN.Cl |
Computed by PubChem (NCBI)