Products 1049740-32-0
CAS 1049740-32-0 appears in our catalog under these names: A 331440 dihydrochloride, A 331440 Dihydrochloride, (R)-4'-(3-(3-(Dimethylamino)pyrrolidin-1-yl)propoxy)-[1,1'-biphenyl]-4-carbonitrile dihydrochloride, ≥98%(HPLC), ≥98%(HPLC), A 331440 (hydrochloride). Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 100mg, 5mg, 10 mg, 25 mg, 5 mg.
4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]benzonitrile;dihydrochloride (CAS 1049740-32-0) is a chemical compound with the molecular formula C22H29Cl2N3O and a molecular weight of 422.4 g/mol. IUPAC name: 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]benzonitrile;dihydrochloride. InChIKey: XFPYVTSGYYMTFS-GHVWMZMZSA-N.
| Molecular formula | C22H29Cl2N3O |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]benzonitrile;dihydrochloride |
| InChIKey | XFPYVTSGYYMTFS-GHVWMZMZSA-N |
| SMILES | CN(C)[C@@H]1CCN(C1)CCCOC2=CC=C(C=C2)C3=CC=C(C=C3)C#N.Cl.Cl |
Computed by PubChem (NCBI)