CAS 1049743-03-4 appears in our catalog under these names: 4-(4-Benzylphenyl)-1,3-thiazol-2-amine hydrobromide, 4-(4-Benzylphenyl)-1,3-thiazol-2-amine, HBr, 95+%, ARM1 hydrobromide. Offered by: Biosynth, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 10mg.
4-(4-benzylphenyl)-1,3-thiazol-2-amine;hydrobromide (CAS 1049743-03-4) is a chemical compound with the molecular formula C16H15BrN2S and a molecular weight of 347.3 g/mol. IUPAC name: 4-(4-benzylphenyl)-1,3-thiazol-2-amine;hydrobromide. InChIKey: JNODWABIDXRUJK-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2S |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 4-(4-benzylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | JNODWABIDXRUJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)C3=CSC(=N3)N.Br |
Computed by PubChem (NCBI)