CAS 1049746-46-4 is the registry number for 4-(Chloromethyl)-n-(4-methoxyphenyl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-(chloromethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine;hydrochloride (CAS 1049746-46-4) is a chemical compound with the molecular formula C11H12Cl2N2OS and a molecular weight of 291.2 g/mol. IUPAC name: 4-(chloromethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: FGHKOSLPADBEAJ-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2OS |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 4-(chloromethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | FGHKOSLPADBEAJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC(=CS2)CCl.Cl |
Computed by PubChem (NCBI)