CAS 1049748-42-6 is the registry number for 4-(Naphthalen-1-yl)aniline hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-naphthalen-1-ylaniline;hydrochloride (CAS 1049748-42-6) is a chemical compound with the molecular formula C16H14ClN and a molecular weight of 255.74 g/mol. IUPAC name: 4-naphthalen-1-ylaniline;hydrochloride. InChIKey: VXPAQOGGARNISS-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 4-naphthalen-1-ylaniline;hydrochloride |
| InChIKey | VXPAQOGGARNISS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=C(C=C3)N.Cl |
Computed by PubChem (NCBI)