CAS 1049751-39-4 appears in our catalog under these names: 1-(4-Nitrobenzenesulfonyl)piperazine hydrochloride, 1-(4-Nitrophenylsulfonyl)piperazine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g, 5g.
1-(4-nitrophenyl)sulfonylpiperazine;hydrochloride (CAS 1049751-39-4) is a chemical compound with the molecular formula C10H14ClN3O4S and a molecular weight of 307.75 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfonylpiperazine;hydrochloride. InChIKey: JTPWHBIELFPYCZ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O4S |
|---|---|
| Molecular weight | 307.75 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | JTPWHBIELFPYCZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)