CAS 1049757-38-1 appears in our catalog under these names: (2-[(4-Fluorobenzyl)thio]phenyl)amine hydrochloride, 95%, {2-((4-fluorobenzyl)thio)phenyl}amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[(4-fluorophenyl)methylsulfanyl]aniline;hydrochloride (CAS 1049757-38-1) is a chemical compound with the molecular formula C13H13ClFNS and a molecular weight of 269.77 g/mol. IUPAC name: 2-[(4-fluorophenyl)methylsulfanyl]aniline;hydrochloride. InChIKey: FLKLIVNEPPNIGU-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFNS |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methylsulfanyl]aniline;hydrochloride |
| InChIKey | FLKLIVNEPPNIGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SCC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)