CAS 1049763-69-0 appears in our catalog under these names: 4,4-Difluoroadamantan-1-amine hydrochloride, 95%, 4,4-Difluoroadamantan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,4-difluoroadamantan-1-amine;hydrochloride (CAS 1049763-69-0) is a chemical compound with the molecular formula C10H16ClF2N and a molecular weight of 223.69 g/mol. IUPAC name: 4,4-difluoroadamantan-1-amine;hydrochloride. InChIKey: HBTHHQBQISPVJE-UHFFFAOYSA-N.
| Molecular formula | C10H16ClF2N |
|---|---|
| Molecular weight | 223.69 g/mol |
| IUPAC name | 4,4-difluoroadamantan-1-amine;hydrochloride |
| InChIKey | HBTHHQBQISPVJE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC(C2)(CC1C3(F)F)N.Cl |
Computed by PubChem (NCBI)