CAS 1049764-63-7 is the registry number for 1-[(2,4-Dimethylphenoxy)methyl]-1h-pyrazol-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-amine;hydrochloride (CAS 1049764-63-7) is a chemical compound with the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. IUPAC name: 1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-amine;hydrochloride. InChIKey: KFXVFMISKDXKMT-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O |
|---|---|
| Molecular weight | 253.73 g/mol |
| IUPAC name | 1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-amine;hydrochloride |
| InChIKey | KFXVFMISKDXKMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCN2C=C(C=N2)N)C.Cl |
Computed by PubChem (NCBI)