CAS 1049765-76-5 appears in our catalog under these names: 1-[(1,1-Dioxidotetrahydrothien-3-yl)carbonyl]piperazine hydrochloride, 95%, (1,1-Dioxidotetrahydrothiophen-3-yl)(piperazin-1-yl)methanone hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(1,1-dioxothiolan-3-yl)-piperazin-1-ylmethanone;hydrochloride (CAS 1049765-76-5) is a chemical compound with the molecular formula C9H17ClN2O3S and a molecular weight of 268.76 g/mol. IUPAC name: (1,1-dioxothiolan-3-yl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: WQQAHYCXAXWNKS-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN2O3S |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | (1,1-dioxothiolan-3-yl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | WQQAHYCXAXWNKS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)