CAS 1049789-48-1 is the registry number for (5-Bromo-2-methoxybenzyl)methylamine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(5-bromo-2-methoxyphenyl)-N-methylmethanamine;hydrobromide (CAS 1049789-48-1) is a chemical compound with the molecular formula C9H13Br2NO and a molecular weight of 311.01 g/mol. IUPAC name: 1-(5-bromo-2-methoxyphenyl)-N-methylmethanamine;hydrobromide. InChIKey: ULKZFMOLOBOHJF-UHFFFAOYSA-N.
| Molecular formula | C9H13Br2NO |
|---|---|
| Molecular weight | 311.01 g/mol |
| IUPAC name | 1-(5-bromo-2-methoxyphenyl)-N-methylmethanamine;hydrobromide |
| InChIKey | ULKZFMOLOBOHJF-UHFFFAOYSA-N |
| SMILES | CNCC1=C(C=CC(=C1)Br)OC.Br |
Computed by PubChem (NCBI)