CAS 10498-35-8 is the registry number for cis-cyclohex-3-enyl-1,2-diamine dihydrochloride. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Cis-(1R,2S)-1,2-dichlorocyclohexane (CAS 10498-35-8) is a chemical compound with the molecular formula C6H10Cl2 and a molecular weight of 153.05 g/mol. IUPAC name: cis-(1R,2S)-1,2-dichlorocyclohexane. InChIKey: GZEZIBFVJYNETN-OLQVQODUSA-N.
| Molecular formula | C6H10Cl2 |
|---|---|
| Molecular weight | 153.05 g/mol |
| IUPAC name | cis-(1R,2S)-1,2-dichlorocyclohexane |
| InChIKey | GZEZIBFVJYNETN-OLQVQODUSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)Cl)Cl |
Computed by PubChem (NCBI)