CAS 10498-85-8 is the registry number for 2,2'–Disulfanediylbis(N,N,N–trimethylethan–1–aminium) iodide. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
Trimethyl-[2-[2-(trimethylazaniumyl)ethyldisulfanyl]ethyl]azanium diiodide (CAS 10498-85-8) is a chemical compound with the molecular formula C10H26I2N2S2 and a molecular weight of 492.3 g/mol. IUPAC name: trimethyl-[2-[2-(trimethylazaniumyl)ethyldisulfanyl]ethyl]azanium diiodide. InChIKey: XJUUVZIZWCSTOD-UHFFFAOYSA-L.
| Molecular formula | C10H26I2N2S2 |
|---|---|
| Molecular weight | 492.3 g/mol |
| IUPAC name | trimethyl-[2-[2-(trimethylazaniumyl)ethyldisulfanyl]ethyl]azanium diiodide |
| InChIKey | XJUUVZIZWCSTOD-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCSSCC[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)