Products 1049823-20-2

CAS 1049823-20-2 is the registry number for 5-(N-(2-Acetamidoethyl)sulfamoyl)thiophene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2-acetamidoethylsulfamoyl)thiophene-3-carboxylic acid (CAS 1049823-20-2) is a chemical compound with the molecular formula C9H12N2O5S2 and a molecular weight of 292.3 g/mol. IUPAC name: 5-(2-acetamidoethylsulfamoyl)thiophene-3-carboxylic acid. InChIKey: PFVRKBQWOLZEPV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O5S2
Molecular weight292.3 g/mol
IUPAC name5-(2-acetamidoethylsulfamoyl)thiophene-3-carboxylic acid
InChIKeyPFVRKBQWOLZEPV-UHFFFAOYSA-N
SMILESCC(=O)NCCNS(=O)(=O)C1=CC(=CS1)C(=O)O

Computed by PubChem (NCBI)