CAS 10504-60-6 appears in our catalog under these names: Diphenyl(methyl)sulfonium Tetrafluoroborate, Methyldiphenylsulfonium tetrafluoroborate, 95% , Diphenyl(methyl)sulfonium Tetrafluoroborate, >95.0%(T), Diphenyl(methyl)sulfonium Tetrafluoroborate, 97%, 97%, Diphenyl(methyl)sulfonium tetrafluoroborate, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g.
Methyl(diphenyl)sulfanium tetrafluoroborate (CAS 10504-60-6) is a chemical compound with the molecular formula C13H13BF4S and a molecular weight of 288.1 g/mol. IUPAC name: methyl(diphenyl)sulfanium tetrafluoroborate. InChIKey: LHAMVDBAOJCBDW-UHFFFAOYSA-N.
| Molecular formula | C13H13BF4S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | methyl(diphenyl)sulfanium tetrafluoroborate |
| InChIKey | LHAMVDBAOJCBDW-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C[S+](C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)