CAS 1050477-30-9 appears in our catalog under these names: (R)-Finerenone, Finerenone Impurity 4. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(4R)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide (CAS 1050477-30-9) is a chemical compound with the molecular formula C21H22N4O3 and a molecular weight of 378.4 g/mol. IUPAC name: (4R)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide. InChIKey: BTBHLEZXCOBLCY-KRWDZBQOSA-N.
| Molecular formula | C21H22N4O3 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (4R)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide |
| InChIKey | BTBHLEZXCOBLCY-KRWDZBQOSA-N |
| SMILES | CCOC1=NC=C(C2=C1[C@H](C(=C(N2)C)C(=O)N)C3=C(C=C(C=C3)C#N)OC)C |
Computed by PubChem (NCBI)