CAS 1050509-11-9 is the registry number for 4-(2,5-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(2,5-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine;hydrobromide (CAS 1050509-11-9) is a chemical compound with the molecular formula C10H9BrCl2N2S and a molecular weight of 340.1 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine;hydrobromide. InChIKey: KUNFMTABVVSWOF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrCl2N2S |
|---|---|
| Molecular weight | 340.1 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | KUNFMTABVVSWOF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=C(C=CC(=C2)Cl)Cl.Br |
Computed by PubChem (NCBI)