CAS 1050509-36-8 is the registry number for 2-(Benzo(d)(1,3)dioxol-5-yloxy)-5-(trifluoromethyl)aniline hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)aniline;hydrochloride (CAS 1050509-36-8) is a chemical compound with the molecular formula C14H11ClF3NO3 and a molecular weight of 333.69 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: RIJAYGGBLPUNGK-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO3 |
|---|---|
| Molecular weight | 333.69 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | RIJAYGGBLPUNGK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OC3=C(C=C(C=C3)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)