Products 1050665-81-0
CAS 1050665-81-0 is the registry number for rel-(3R,5S)-1-tert-butoxycarbonyl-5-phenyl-piperidine-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid (CAS 1050665-81-0) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid. InChIKey: BNUHNLZVJMQDJJ-ZIAGYGMSSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid |
| InChIKey | BNUHNLZVJMQDJJ-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H](C1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)