CAS 1050824-22-0 is the registry number for N-(tert-Butyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide (CAS 1050824-22-0) is a chemical compound with the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. IUPAC name: N-tert-butyl-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide. InChIKey: DVEKJHIIXPAHAQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | N-tert-butyl-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide |
| InChIKey | DVEKJHIIXPAHAQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)C(=O)NC(C)(C)C)C |
Computed by PubChem (NCBI)