Products 105086-80-4
CAS 105086-80-4 is the registry number for (S)-(-)-5-METHOXY 2-AMINOTETRALIN, 95%. Offered by: Fluorochem. Available pack sizes: 50mg.
(2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine (CAS 105086-80-4) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine. InChIKey: SIHPGAYIYYGOIP-VIFPVBQESA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChIKey | SIHPGAYIYYGOIP-VIFPVBQESA-N |
| SMILES | COC1=CC=CC2=C1CC[C@@H](C2)N |
Computed by PubChem (NCBI)