Products 105114-23-6
CAS 105114-23-6 is the registry number for 4-Diazo-3-methoxy-2,5-cyclohexadien-1-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-diazonio-3-methoxyphenolate (CAS 105114-23-6) is a chemical compound with the molecular formula C7H6N2O2 and a molecular weight of 150.13 g/mol. IUPAC name: 4-diazonio-3-methoxyphenolate. InChIKey: JGURBIRPPYXGNF-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 4-diazonio-3-methoxyphenolate |
| InChIKey | JGURBIRPPYXGNF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[O-])[N+]#N |
Computed by PubChem (NCBI)