Products 1051174-86-7

CAS 1051174-86-7 is the registry number for 4-Bromo-3-(N-(2-hydroxypropyl)sulfamoyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-3-(2-hydroxypropylsulfamoyl)benzoic acid (CAS 1051174-86-7) is a chemical compound with the molecular formula C10H12BrNO5S and a molecular weight of 338.18 g/mol. IUPAC name: 4-bromo-3-(2-hydroxypropylsulfamoyl)benzoic acid. InChIKey: VHHBFGCCSYIPMR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BrNO5S
Molecular weight338.18 g/mol
IUPAC name4-bromo-3-(2-hydroxypropylsulfamoyl)benzoic acid
InChIKeyVHHBFGCCSYIPMR-UHFFFAOYSA-N
SMILESCC(CNS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Br)O

Computed by PubChem (NCBI)