Products 1051177-61-7
CAS 1051177-61-7 is the registry number for FabG1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(3,4-dichlorobenzoyl)amino]-5-iodobenzoic acid (CAS 1051177-61-7) is a chemical compound with the molecular formula C14H8Cl2INO3 and a molecular weight of 436.0 g/mol. IUPAC name: 2-[(3,4-dichlorobenzoyl)amino]-5-iodobenzoic acid. InChIKey: UBOXQKDXBUFYSA-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2INO3 |
|---|---|
| Molecular weight | 436.0 g/mol |
| IUPAC name | 2-[(3,4-dichlorobenzoyl)amino]-5-iodobenzoic acid |
| InChIKey | UBOXQKDXBUFYSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=C(C=C(C=C2)I)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
FabG1-IN-1, orb1687559