Products 105118-14-7
CAS 105118-14-7 appears in our catalog under these names: Datelliptium chloride, Datelliptium chloride, Datelliptium (chloride), 98.33%, 2-[2-(diethylamino)ethyl]-9-hydroxy-5,11-dimethyl-6H-Pyrido[4,3-b]carbazolium, chloride (1:1), 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 25mg, 1mg, 10mM (in 1ml water), 20mg, 5mg, 50 mg, 100 mg, 5 mg.
2-[2-(diethylamino)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride (CAS 105118-14-7) is a chemical compound with the molecular formula C23H28ClN3O and a molecular weight of 397.9 g/mol. IUPAC name: 2-[2-(diethylamino)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride. InChIKey: UCICRVXYPSKKJK-UHFFFAOYSA-N.
| Molecular formula | C23H28ClN3O |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | 2-[2-(diethylamino)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride |
| InChIKey | UCICRVXYPSKKJK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC[N+]1=CC2=C(C3=C(C(=C2C=C1)C)NC4=C3C=C(C=C4)O)C.[Cl-] |
Computed by PubChem (NCBI)