CAS 1051374-19-6 is the registry number for (R)-4-((Tritylthio)methyl)oxazolidine-2,5-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4R)-4-(tritylsulfanylmethyl)-1,3-oxazolidine-2,5-dione (CAS 1051374-19-6) is a chemical compound with the molecular formula C23H19NO3S and a molecular weight of 389.5 g/mol. IUPAC name: (4R)-4-(tritylsulfanylmethyl)-1,3-oxazolidine-2,5-dione. InChIKey: CMOHSMWDOMUIOJ-FQEVSTJZSA-N.
| Molecular formula | C23H19NO3S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | (4R)-4-(tritylsulfanylmethyl)-1,3-oxazolidine-2,5-dione |
| InChIKey | CMOHSMWDOMUIOJ-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@H]4C(=O)OC(=O)N4 |
Computed by PubChem (NCBI)