CAS 105140-25-8 appears in our catalog under these names: 3-[N-Tris(hydroxymethyl)methylamino]-2-hydroxypropanesulfonic acid sodium salt, 95%, Sodium 3–((1,3–dihydroxy–2–(hydroxymethyl)propan–2–yl)amino)–2–hydroxypropane–1–sulfonate, 3-(N-Tris(hydroxymethyl)methylamino)-2-hydroxypropanesulfonic acid sodium salt, TAPSO sodium salt, 99.00%, TAPSO sodium 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 100g, 25g, 1g, 500g, 10g, 50g, Get quote.
Sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate (CAS 105140-25-8) is a chemical compound with the molecular formula C7H16NNaO7S and a molecular weight of 281.26 g/mol. IUPAC name: sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate. InChIKey: XRADYQRMWVBZEH-UHFFFAOYSA-M.
| Molecular formula | C7H16NNaO7S |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate |
| InChIKey | XRADYQRMWVBZEH-UHFFFAOYSA-M |
| SMILES | C(C(CS(=O)(=O)[O-])O)NC(CO)(CO)CO.[Na+] |
Computed by PubChem (NCBI)