CAS 105172-64-3 appears in our catalog under these names: Levothyroxine Impurity 54, O-(4-Hydroxy-3-iodo-5-nitrophenyl)-3,5-diiodo-L-tyrosine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(2S)-2-amino-3-[4-(4-hydroxy-3-iodo-5-nitrophenoxy)-3,5-diiodophenyl]propanoic acid (CAS 105172-64-3) is a chemical compound with the molecular formula C15H11I3N2O6 and a molecular weight of 695.97 g/mol. IUPAC name: (2S)-2-amino-3-[4-(4-hydroxy-3-iodo-5-nitrophenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: OQLZPBQQKUCBKW-NSHDSACASA-N.
| Molecular formula | C15H11I3N2O6 |
|---|---|
| Molecular weight | 695.97 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(4-hydroxy-3-iodo-5-nitrophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | OQLZPBQQKUCBKW-NSHDSACASA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)[N+](=O)[O-])I)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)