CAS 105182-47-6 appears in our catalog under these names: (3aR,9aR)-Fluparoxan/ 98.68% (existing batch purity), (3aR,9aR)-Fluparoxan, (3aR,9aR)-Fluparoxan. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
(3aR,9aR)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole (CAS 105182-47-6) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: (3aR,9aR)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole. InChIKey: XSOUHEXVEOQRKJ-RKDXNWHRSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | (3aR,9aR)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole |
| InChIKey | XSOUHEXVEOQRKJ-RKDXNWHRSA-N |
| SMILES | C1[C@@H]2[C@@H](CN1)OC3=C(O2)C=CC=C3F |
Computed by PubChem (NCBI)