CAS 10522-43-7 is the registry number for 2,5-Dimethylquinolin-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,5-dimethylquinolin-8-ol (CAS 10522-43-7) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,5-dimethylquinolin-8-ol. InChIKey: GQUFSGXAEOXQJC-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,5-dimethylquinolin-8-ol |
| InChIKey | GQUFSGXAEOXQJC-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=NC2=C(C=C1)O)C |
Computed by PubChem (NCBI)