CAS 105241-88-1 appears in our catalog under these names: H–Arg–Gly–OH · HCl, H-Arg-Gly-OH·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 5000mg.
2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride (CAS 105241-88-1) is a chemical compound with the molecular formula C8H18ClN5O3 and a molecular weight of 267.71 g/mol. IUPAC name: 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride. InChIKey: LBJDXUKLQUTBSV-JEDNCBNOSA-N.
| Molecular formula | C8H18ClN5O3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride |
| InChIKey | LBJDXUKLQUTBSV-JEDNCBNOSA-N |
| SMILES | C(C[C@@H](C(=O)NCC(=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)