CAS 1052411-49-0 is the registry number for N2-Phenyl-2,4-quinazolinediamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-N-phenylquinazoline-2,4-diamine;hydrochloride (CAS 1052411-49-0) is a chemical compound with the molecular formula C14H13ClN4 and a molecular weight of 272.73 g/mol. IUPAC name: 2-N-phenylquinazoline-2,4-diamine;hydrochloride. InChIKey: RAMJTIDFCDOMHW-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 2-N-phenylquinazoline-2,4-diamine;hydrochloride |
| InChIKey | RAMJTIDFCDOMHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC3=CC=CC=C3C(=N2)N.Cl |
Computed by PubChem (NCBI)