CAS 1052537-37-7 is the registry number for 4-(Chloromethyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazole;hydrochloride (CAS 1052537-37-7) is a chemical compound with the molecular formula C12H13Cl2NO2S and a molecular weight of 306.2 g/mol. IUPAC name: 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazole;hydrochloride. InChIKey: SCVPWOZFKMIFNC-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO2S |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazole;hydrochloride |
| InChIKey | SCVPWOZFKMIFNC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC(=CS2)CCl)OC.Cl |
Computed by PubChem (NCBI)