CAS 1052537-94-6 is the registry number for 4-(Chloromethyl)-2-(4-ethoxyphenyl)-1,3-thiazole hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(chloromethyl)-2-(4-ethoxyphenyl)-1,3-thiazole;hydrochloride (CAS 1052537-94-6) is a chemical compound with the molecular formula C12H13Cl2NOS and a molecular weight of 290.2 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-ethoxyphenyl)-1,3-thiazole;hydrochloride. InChIKey: DYKJHUFSEJCYFN-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NOS |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-ethoxyphenyl)-1,3-thiazole;hydrochloride |
| InChIKey | DYKJHUFSEJCYFN-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=NC(=CS2)CCl.Cl |
Computed by PubChem (NCBI)