CAS 1052549-39-9 appears in our catalog under these names: 3-Benzyl-4-(difluoromethoxy)aniline hydrochloride, 95%, 3-Benzyl-4-(difluoromethoxy)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-benzyl-4-(difluoromethoxy)aniline;hydrochloride (CAS 1052549-39-9) is a chemical compound with the molecular formula C14H14ClF2NO and a molecular weight of 285.71 g/mol. IUPAC name: 3-benzyl-4-(difluoromethoxy)aniline;hydrochloride. InChIKey: QVLZRNWEKCFCRT-UHFFFAOYSA-N.
| Molecular formula | C14H14ClF2NO |
|---|---|
| Molecular weight | 285.71 g/mol |
| IUPAC name | 3-benzyl-4-(difluoromethoxy)aniline;hydrochloride |
| InChIKey | QVLZRNWEKCFCRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=CC(=C2)N)OC(F)F.Cl |
Computed by PubChem (NCBI)