CAS 1052550-77-2 is the registry number for 4-(2,5-Dimethyl-1-phenyl-1h-pyrrol-3-yl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1052550-77-2) is a chemical compound with the molecular formula C15H16ClN3S and a molecular weight of 305.8 g/mol. IUPAC name: 4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: OPZSNUUPEIWMQO-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3S |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 4-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | OPZSNUUPEIWMQO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2)C)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)