CAS 105279-24-1 appears in our catalog under these names: Azelastine Impurity 25, (E)-3-(3-Chlorobenzylidene)isobenzofuran-1(3H)-one, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
(3E)-3-[(3-chlorophenyl)methylidene]-2-benzofuran-1-one (CAS 105279-24-1) is a chemical compound with the molecular formula C15H9ClO2 and a molecular weight of 256.68 g/mol. IUPAC name: (3E)-3-[(3-chlorophenyl)methylidene]-2-benzofuran-1-one. InChIKey: TWFDIKOXKSCOGG-NTEUORMPSA-N.
| Molecular formula | C15H9ClO2 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | (3E)-3-[(3-chlorophenyl)methylidene]-2-benzofuran-1-one |
| InChIKey | TWFDIKOXKSCOGG-NTEUORMPSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C\C3=CC(=CC=C3)Cl)/OC2=O |
Computed by PubChem (NCBI)