CAS 10420-73-2 appears in our catalog under these names: 6-Chloroflavone, 97%, 6–Chloroflavone, 6-Chloroflavone, 6-Chloroflavone, >98.0%(GC), 6-Chloro-2-phenyl-4H-chromen-4-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 2g, 10g, 100mg.
6-chloro-2-phenylchromen-4-one (CAS 10420-73-2) is a chemical compound with the molecular formula C15H9ClO2 and a molecular weight of 256.68 g/mol. IUPAC name: 6-chloro-2-phenylchromen-4-one. InChIKey: IFNDLWHUYFSXBK-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO2 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 6-chloro-2-phenylchromen-4-one |
| InChIKey | IFNDLWHUYFSXBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)