CAS 105300-43-4 is the registry number for (Rac)-Fidarestat, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide (CAS 105300-43-4) is a chemical compound with the molecular formula C12H10FN3O4 and a molecular weight of 279.22 g/mol. IUPAC name: 6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide. InChIKey: WAAPEIZFCHNLKK-UHFFFAOYSA-N.
| Molecular formula | C12H10FN3O4 |
|---|---|
| Molecular weight | 279.22 g/mol |
| IUPAC name | 6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide |
| InChIKey | WAAPEIZFCHNLKK-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C13C(=O)NC(=O)N3)C=C(C=C2)F)C(=O)N |
Computed by PubChem (NCBI)