Products 105319-39-9

CAS 105319-39-9 is the registry number for 3,3,3-Trichloro-2-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3,3-trichloro-2-oxopropanoic acid (CAS 105319-39-9) is a chemical compound with the molecular formula C3HCl3O3 and a molecular weight of 191.39 g/mol. IUPAC name: 3,3,3-trichloro-2-oxopropanoic acid. InChIKey: FCVVMWCTXQMCQC-UHFFFAOYSA-N.

Identity
Molecular formulaC3HCl3O3
Molecular weight191.39 g/mol
IUPAC name3,3,3-trichloro-2-oxopropanoic acid
InChIKeyFCVVMWCTXQMCQC-UHFFFAOYSA-N
SMILESC(=O)(C(=O)O)C(Cl)(Cl)Cl

Computed by PubChem (NCBI)