CAS 105328-90-3 is the registry number for H–D–Ala–D–Ala–OMe · HCl. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl (2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoate;hydrochloride (CAS 105328-90-3) is a chemical compound with the molecular formula C7H15ClN2O3 and a molecular weight of 210.66 g/mol. IUPAC name: methyl (2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoate;hydrochloride. InChIKey: WVSVBOMWSCRPGM-TYSVMGFPSA-N.
| Molecular formula | C7H15ClN2O3 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | methyl (2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoate;hydrochloride |
| InChIKey | WVSVBOMWSCRPGM-TYSVMGFPSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)