CAS 105331-00-8 appears in our catalog under these names: Azacitidine Impurity 13, 6-Amino-5-azacytidine, 6-Amino-5-azacytidine/ 99.89% (existing batch purity), 6-Amino-5-azacytidine 97%, 6-Amino-5-azacytidine, 95%, 95%. Offered by: Chemat Brand, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
4,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one (CAS 105331-00-8) is a chemical compound with the molecular formula C8H13N5O5 and a molecular weight of 259.22 g/mol. IUPAC name: 4,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one. InChIKey: HHBIDXKTBPRKSK-TXICZTDVSA-N.
| Molecular formula | C8H13N5O5 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| InChIKey | HHBIDXKTBPRKSK-TXICZTDVSA-N |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C(=NC(=NC2=O)N)N)O)O)O |
Computed by PubChem (NCBI)